| Product Name | 2,5-difluorophenylhydrazine hydrochloride |
| CAS No. | 175135-73-6 |
| Synonyms | 1,1,1,3-tetrachloro-2,2,3,3-tetrafluoropropane; (2,5-difluorophenyl)diazanium chloride |
| InChI | InChI=1/C6H6F2N2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
| Molecular Formula | C6H7ClF2N2 |
| Molecular Weight | 180.583 |
| Melting point | 210℃ |
| Boiling point | 189.5°C at 760 mmHg |
| Flash point | 68.4°C |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175135-73-6 2,5-difluorophenylhydrazine hydrochloride
service@apichina.com