| Product Name | 2,5-Difluorophenylglyoxal hydrate |
| CAS No. | 81593-28-4 |
| Synonyms | (2,5-difluorophenyl)(oxo)acetaldehyde hydrate |
| InChI | InChI=1/C8H4F2O2.H2O/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-4H;1H2 |
| Molecular Formula | C8H6F2O3 |
| Molecular Weight | 188.1282 |
| Boiling point | 224.7°C at 760 mmHg |
| Flash point | 84.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
81593-28-4 2,5-difluorophenylglyoxal hydrate
service@apichina.com