| Product Name | 2,5-difluorophenyl isothiocyanate |
| CAS No. | 206559-57-1 |
| Synonyms | 1,4-difluoro-2-isocyanatobenzene |
| InChI | InChI=1/C7H3F2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| Molecular Formula | C7H3F2NO |
| Molecular Weight | 155.1016 |
| Density | 1.24g/cm3 |
| Boiling point | 181.1°C at 760 mmHg |
| Flash point | 56.1°C |
| Refractive index | 1.488 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
206559-57-1 2,5-difluorophenyl isothiocyanate
service@apichina.com