| Product Name | 2,5-Dichlorotoluene |
| CAS No. | 19398-61-9 |
| Synonyms | Benzene, 1,4-dichloro-2-methyl-; NSC 86117; Toluene, 2,5-dichloro- (8CI); 1,4-dichloro-2-methylbenzene |
| InChI | InChI=1/C7H6Cl2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| Molecular Formula | C7H6Cl2 |
| Molecular Weight | 161.0285 |
| Density | 1.242g/cm3 |
| Melting point | 4-5℃ |
| Boiling point | 197.4°C at 760 mmHg |
| Flash point | 79.4°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
19398-61-9 2,5-dichlorotoluene
service@apichina.com