| Product Name | 2,5-Dichlorothiophene-3-carboxylic acid |
| CAS No. | 36157-41-2 |
| Synonyms | 2,5-Dichloro-3-Thiopheneformic Acid; 2,5-dichlorothiophene-3-carboxylate |
| InChI | InChI=1/C5H2Cl2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)/p-1 |
| Molecular Formula | C5HCl2O2S |
| Molecular Weight | 196.0318 |
| Boiling point | 296.6°C at 760 mmHg |
| Flash point | 133.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
36157-41-2 2,5-dichlorothiophene-3-carboxylic acid
service@apichina.com