| Product Name | 2,5-dichlorothiophene-3-carbonyl chloride |
| CAS No. | 57248-14-3 |
| InChI | InChI=1/C5HCl3OS/c6-3-1-2(4(7)9)5(8)10-3/h1H |
| Molecular Formula | C5HCl3OS |
| Molecular Weight | 215.4848 |
| Density | 1.667g/cm3 |
| Boiling point | 244.3°C at 760 mmHg |
| Flash point | 101.5°C |
| Refractive index | 1.607 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
57248-14-3 2,5-dichlorothiophene-3-carbonyl chloride
service@apichina.com