| Sales Email | Service@apichina.com |
| CAS No. | 305-15-7 |
| Product Name | 2,5-Dichlorophenylhydrazine |
| Synonyms | -2,5-DICHLOROPHENYLHYDRAZINE; 1-(2,5-DICHLOROPHENYL)HYDRAZINE; (2,5-dichlorophenyl)-hydrazin; Hydrazine, (2,5-dichlorophenyl)-; 2,5-DICHLOROPHENYLHYRAZINE |
| InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.0312 |
| Density | 1.475g/cm3 |
| Melting point | 100-104℃ |
| Boiling point | 266.8°C at 760 mmHg |
| Flash point | 115.1°C |
| Refractive index | 1.665 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
