| Product Name | 2,5-dichlorophenyl isocyanate |
| CAS No. | 5392-82-5 |
| Synonyms | Isocyanic acid 2,5-dichlorophenyl ester; 2,5-Dichloroisocyanatobenzene; 1,4-dichloro-2-isocyanatobenzene |
| InChI | InChI=1/C7H3Cl2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| Molecular Formula | C7H3Cl2NO |
| Molecular Weight | 188.0108 |
| Density | 1.37g/cm3 |
| Melting point | 29-31℃ |
| Boiling point | 241.6°C at 760 mmHg |
| Flash point | 92°C |
| Refractive index | 1.575 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5392-82-5 2,5-dichlorophenyl isocyanate
service@apichina.com