| Product Name | 2,5-Dichlorobenzhydrazide |
| CAS No. | 67487-35-8 |
| Synonyms | 2,5-Dichlorobenzoic acid hydrazide; 2,5-dichlorobenzohydrazide |
| InChI | InChI=1/C7H6Cl2N2O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,10H2,(H,11,12) |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.0413 |
| Density | 1.455g/cm3 |
| Melting point | 180-181℃ |
| Refractive index | 1.605 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
67487-35-8 2,5-dichlorobenzhydrazide
service@apichina.com