| Product Name | 2,5-Dichlorobenzeneboronic acid |
| CAS No. | 135145-90-3 |
| Synonyms | 2,5-Dichlorophenylboronic acid |
| InChI | InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| Molecular Formula | C6H5BCl2O2 |
| Molecular Weight | 190.8197 |
| Density | 1.47g/cm3 |
| Melting point | 150℃ |
| Boiling point | 343.6°C at 760 mmHg |
| Flash point | 161.6°C |
| Refractive index | 1.577 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
135145-90-3 2,5-dichlorobenzeneboronic acid
service@apichina.com