| Product Name | 2,5-dichloro-4,6-dimethylnicotinonitrile |
| CAS No. | 91591-63-8 |
| Synonyms | 2,5-dichloro-4,6-dimethylpyridine-3-carbonitrile |
| InChI | InChI=1/C8H6Cl2N2/c1-4-6(3-11)8(10)12-5(2)7(4)9/h1-2H3 |
| Molecular Formula | C8H6Cl2N2 |
| Molecular Weight | 201.0526 |
| Density | 1.36g/cm3 |
| Melting point | 78℃ |
| Boiling point | 304.6°C at 760 mmHg |
| Flash point | 138°C |
| Refractive index | 1.564 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
91591-63-8 2,5-dichloro-4,6-dimethylnicotinonitrile
service@apichina.com