| Product Name | 2,5-dichloro-3-nitrobenzoic acid |
| CAS No. | 88-86-8 |
| Synonyms | Benzoic acid, 2,5-dichloro-3-nitro-; 2,5-Dichloro-3-nitrobenzoic acid; 2,5-Dichloro-4-nitrobenzoic acid; 2-09-00-00276 (Beilstein Handbook Reference); 3-Nitro-2,5-dichlorobenzoic acid; BRN 1976119; Caswell No. 312; Dinoben; EPA Pesticide Chemical Code 028101; Kyselina 2,5-dichlor-3-nitrobenzoova; Kyselina 2,5-dichlor-3-nitrobenzoova [Czech] |
| InChI | InChI=1/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) |
| Molecular Formula | C7H3Cl2NO4 |
| Molecular Weight | 236.009 |
| Density | 1.713g/cm3 |
| Melting point | 216-220℃ |
| Boiling point | 366.5°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.638 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
88-86-8 2,5-dichloro-3-nitrobenzoic acid
service@apichina.com