| Product Name | 2,5-Dibromo-3-methylthiophene |
| CAS No. | 13191-36-1 |
| InChI | InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
| Molecular Formula | C5H4Br2S |
| Molecular Weight | 255.9583 |
| Density | 2.006g/cm3 |
| Boiling point | 230.2°C at 760 mmHg |
| Flash point | 93°C |
| Refractive index | 1.62 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13191-36-1 2,5-dibromo-3-methylthiophene
service@apichina.com