| Product Name | 2,5-Dibromo-3,4-dinitrothiophene |
| CAS No. | 52431-30-8 |
| Synonyms | 2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| InChI | InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| Molecular Formula | C4Br2N2O4S |
| Molecular Weight | 331.9268 |
| Density | 2.459g/cm3 |
| Boiling point | 341.2°C at 760 mmHg |
| Flash point | 160.2°C |
| Refractive index | 1.716 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
52431-30-8 2,5-dibromo-3,4-dinitrothiophene
service@apichina.com