| Product Name | 2,5-Diamino-3-picoline |
| CAS No. | 106070-58-0 |
| Synonyms | 3-methylpyridine-2,5-diamine; 2,5-diamino-3-methylpyridinium |
| InChI | InChI=1/C6H9N3/c1-4-2-5(7)3-9-6(4)8/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
| Molecular Formula | C6H10N3 |
| Molecular Weight | 124.1632 |
| Boiling point | 329.2°C at 760 mmHg |
| Flash point | 179.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
106070-58-0 2,5-diamino-3-picoline
service@apichina.com