| Product Name | 2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine |
| CAS No. | 175135-51-0 |
| Synonyms | 2-[(5-chloropyridin-3-yl)oxy]-3-nitropyridine |
| InChI | InChI=1/C10H6ClN3O3/c11-7-4-8(6-12-5-7)17-10-9(14(15)16)2-1-3-13-10/h1-6H |
| Molecular Formula | C10H6ClN3O3 |
| Molecular Weight | 251.6259 |
| Density | 1.477g/cm3 |
| Melting point | 104℃ |
| Boiling point | 374.2°C at 760 mmHg |
| Flash point | 180.1°C |
| Refractive index | 1.626 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175135-51-0 2-[(5-chloro-3-pyridyl)oxy]-3-nitropyridine
service@apichina.com