| Product Name | 2-(5-bromo-2-thienyl)pyridine |
| CAS No. | 123784-07-6 |
| Synonyms | 2-(5-bromothiophen-2-yl)pyridine |
| InChI | InChI=1/C9H6BrNS/c10-9-5-4-8(12-9)7-3-1-2-6-11-7/h1-6H |
| Molecular Formula | C9H6BrNS |
| Molecular Weight | 240.1196 |
| Density | 1.563g/cm3 |
| Melting point | 86℃ |
| Boiling point | 301.7°C at 760 mmHg |
| Flash point | 136.2°C |
| Refractive index | 1.635 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
123784-07-6 2-(5-bromo-2-thienyl)pyridine
service@apichina.com