| Product Name | 2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide |
| CAS No. | 206559-44-6 |
| Synonyms | 5-Bromo-2-methoxyphenethylamine hydrobromide; 2-(5-bromo-2-methoxyphenyl)ethanaminium bromide |
| InChI | InChI=1/C9H12BrNO.BrH/c1-12-9-3-2-8(10)6-7(9)4-5-11;/h2-3,6H,4-5,11H2,1H3;1H |
| Molecular Formula | C9H13Br2NO |
| Molecular Weight | 311.0136 |
| Boiling point | 296.9°C at 760 mmHg |
| Flash point | 133.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
206559-44-6 2-(5-bromo-2-methoxyphenyl)ethylamine hydrobromide
service@apichina.com