| Product Name | 2,5-Bis(4-pyridyl)-1,3,4-thiadiazole |
| CAS No. | 15311-09-8;54010-21-8 |
| Synonyms | 4,4'-(2,5-dihydro-1,3,4-thiadiazole-2,5-diyl)dipyridine; Pyridine, 4,4'-(1,3,4-thiadiazole-2,5-diyl)di-; 1,3,4-Thiazole, 2,5-bis(4-piridinyl)-; 2,5-Bis(4-piridinyl)-1,3,4-thiadiazole; 4,4'-(1,3,4-Thiadiazole-2,5-diyl)dipyridine; 4-27-00-09589 (Beilstein Handbook Reference); BRN 0198070; NSC 34795 |
| InChI | InChI=1/C12H8N4S/c1-5-13-6-2-9(1)11-15-16-12(17-11)10-3-7-14-8-4-10/h1-8H |
| Molecular Formula | C12H8N4S |
| Molecular Weight | 240.2837 |
| Density | 1.317g/cm3 |
| Melting point | 237-244℃ |
| Boiling point | 475.9°C at 760 mmHg |
| Flash point | 238.6°C |
| Refractive index | 1.645 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
15311-09-8;54010-21-8 2,5-bis(4-pyridyl)-1,3,4-thiadiazole
service@apichina.com