| Product Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-5-nitrobenzonitrile |
| CAS No. | 175135-68-9 |
| Synonyms | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitrobenzonitrile |
| InChI | InChI=1/C9H5N5O2S2/c10-4-5-3-6(14(15)16)1-2-7(5)17-9-13-12-8(11)18-9/h1-3H,(H2,11,12) |
| Molecular Formula | C9H5N5O2S2 |
| Molecular Weight | 279.2983 |
| Density | 1.69g/cm3 |
| Melting point | 245℃ |
| Boiling point | 545.4°C at 760 mmHg |
| Flash point | 283.6°C |
| Refractive index | 1.752 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
175135-68-9 2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-5-nitrobenzonitrile
service@apichina.com