| Product Name | 2-[5-(2-chloroacetyl)-2-thienyl]acetic acid |
| CAS No. | 175203-15-3 |
| Synonyms | 5-(Chloroacetyl)thiophene-2-acetic acid; [5-(chloroacetyl)thiophen-2-yl]acetic acid |
| InChI | InChI=1/C8H7ClO3S/c9-4-6(10)7-2-1-5(13-7)3-8(11)12/h1-2H,3-4H2,(H,11,12) |
| Molecular Formula | C8H7ClO3S |
| Molecular Weight | 218.6574 |
| Density | 1.464g/cm3 |
| Melting point | 105℃ |
| Boiling point | 429.3°C at 760 mmHg |
| Flash point | 213.4°C |
| Refractive index | 1.593 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175203-15-3 2-[5-(2-chloroacetyl)-2-thienyl]acetic acid
service@apichina.com