| Product Name | 2-(4-Methylbenzoyl)benzoic acid |
| CAS No. | 85-55-2 |
| Synonyms | 2-(p-Toluoyl)benzoic acid; 4-Methylbenzophenone-2-carboxylic acid; 2-[(4-methylphenyl)carbonyl]benzoate |
| InChI | InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
| Molecular Formula | C15H11O3 |
| Molecular Weight | 239.2466 |
| Melting point | 137-139℃ |
| Boiling point | 457.1°C at 760 mmHg |
| Flash point | 244.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
85-55-2 2-(4-methylbenzoyl)benzoic acid
service@apichina.com