| Product Name | 2-[4-(methoxycarbonyl)-5-methyl-2-oxo-2,3-dihydro-1H-pyrrol-3-yl]acetic acid |
| CAS No. | 77978-73-5 |
| Synonyms | [4-(methoxycarbonyl)-5-methyl-2-oxo-2,3-dihydro-1H-pyrrol-3-yl]acetic acid |
| InChI | InChI=1/C9H11NO5/c1-4-7(9(14)15-2)5(3-6(11)12)8(13)10-4/h5H,3H2,1-2H3,(H,10,13)(H,11,12) |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.1873 |
| Density | 1.329g/cm3 |
| Melting point | 160℃ |
| Boiling point | 482.2°C at 760 mmHg |
| Flash point | 245.4°C |
| Refractive index | 1.511 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
77978-73-5 2-[4-(methoxycarbonyl)-5-methyl-2-oxo-2,3-dihydro-1h-pyrrol-3-yl]acetic acid
service@apichina.com