| Product Name | 2,4-Hexadienyl acetate |
| CAS No. | 1516-17-2 |
| Synonyms | trans,trans-2,4-Hexadienyl acetate; hexa-2,4-dien-1-yl acetate; (2E,4E)-hexa-2,4-dien-1-yl acetate |
| InChI | InChI=1/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.1797 |
| Density | 0.926g/cm3 |
| Boiling point | 186.5°C at 760 mmHg |
| Flash point | 79.6°C |
| Refractive index | 1.454 |
| Risk Codes | R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1516-17-2 2,4-hexadienyl acetate
service@apichina.com