| Product Name | 2,4-dioxohexahydropyrimidin-5-ylboronic acid |
| CAS No. | 306935-91-1 |
| InChI | InChI=1/C4H7BN2O4/c8-3-2(5(10)11)1-6-4(9)7-3/h2,10-11H,1H2,(H2,6,7,8,9) |
| Molecular Formula | C4H7BN2O4 |
| Molecular Weight | 157.9204 |
| Density | 1.51g/cm3 |
| Melting point | 300℃ |
| Refractive index | 1.537 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
306935-91-1 2,4-dioxohexahydropyrimidin-5-ylboronic acid
service@apichina.com