| Product Name | 2,4-Dinitrotoluene |
| CAS No. | 121-14-2 |
| Synonyms | 2,4-dinitrotoluene moistened with water (H2O ~10%); 2,4-DNT; 1-Methyl-2,4-dinitrobenzene; 1-methyl-2,3-dinitrobenzene |
| InChI | InChI=1/C7H6N2O4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3 |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.1335 |
| Density | 1.407g/cm3 |
| Melting point | 65.5-70.5℃ |
| Boiling point | 331.5°C at 760 mmHg |
| Flash point | 170.2°C |
| Water solubility | 0.3 g/L (20℃) |
| Refractive index | 1.598 |
| Hazard Symbols |  T:Toxic;  N:Dangerous for the environment; |
| Risk Codes | R23/24/25:; R45:; R48/22:; R51/53:; R62:; R68:; |
| Safety | S45:; S53:; S61:; |
121-14-2 2,4-dinitrotoluene
service@apichina.com