| Product Name | 2,4-Dinitrophenyl thiocyanate |
| CAS No. | 1594-56-5 |
| Synonyms | 2,4-Dinitrothiocyanatobenzene |
| InChI | InChI=1/C7H3N3O4S/c8-4-15-7-2-1-5(9(11)12)3-6(7)10(13)14/h1-3H |
| Molecular Formula | C7H3N3O4S |
| Molecular Weight | 225.1814 |
| Density | 1.62g/cm3 |
| Melting point | 138-140℃ |
| Boiling point | 368.4°C at 760 mmHg |
| Flash point | 176.6°C |
| Refractive index | 1.666 |
| Risk Codes | R32:Contact with acids liberates very toxic gas.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1594-56-5 2,4-dinitrophenyl thiocyanate
service@apichina.com