| Product Name | 2,4-Dinitrophenol |
| CAS No. | 51-28-5 |
| Synonyms | 2,4-dinitrophenol moistened with water (H(2)O ~20%); 2,4-dinitrophenol, reagent grade; 2,4-dinitrophenol, industry grade; 2,4-dinitrophenolate |
| InChI | InChI=1/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H/p-1 |
| Molecular Formula | C6H3N2O5 |
| Molecular Weight | 183.099 |
| Melting point | 106-112℃ |
| Boiling point | 312.1°C at 760 mmHg |
| Flash point | 142.8°C |
| Water solubility | 0.6 g/100 mL (18℃) |
| Hazard Symbols |  T:Toxic;  N:Dangerous for the environment; |
| Risk Codes | R23/24/25:; R33:; R50:; |
| Safety | S28A:; S37:; S45:; S61:; |
51-28-5 2,4-dinitrophenol
service@apichina.com