| Product Name | 2,4-Dinitrobenzyl chloride |
| CAS No. | 610-57-1 |
| Synonyms | alpha-Chloro-2,4-dinitrotoluene; 4-(Chloromethyl)-1,3-dinitrobenzene; 1-(chloromethyl)-2,4-dinitrobenzene |
| InChI | InChI=1/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
| Molecular Formula | C7H5ClN2O4 |
| Molecular Weight | 216.5786 |
| Density | 1.538g/cm3 |
| Melting point | 34-36℃ |
| Boiling point | 349.8°C at 760 mmHg |
| Flash point | 165.4°C |
| Refractive index | 1.614 |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
610-57-1 2,4-dinitrobenzyl chloride
service@apichina.com