| Product Name | 2,4-dinitrobenzenesulfenyl chloride |
| CAS No. | 528-76-7 |
| Synonyms | 2,4-Dinitrophenylsulfenyl chloride; 2,4-Dinitrobenzenesulphenyl chloride; 1-(chlorosulfanyl)-2,4-dinitrobenzene |
| InChI | InChI=1/C6H3ClN2O4S/c7-14-6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| Molecular Formula | C6H3ClN2O4S |
| Molecular Weight | 234.617 |
| Density | 1.68g/cm3 |
| Melting point | 94-97℃ |
| Boiling point | 430.1°C at 760 mmHg |
| Flash point | 213.9°C |
| Refractive index | 1.662 |
| Risk Codes | R34:Causes burns.; R37:Irritating to respiratory system.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
528-76-7 2,4-dinitrobenzenesulfenyl chloride
service@apichina.com