| Product Name | 2,4-dinitro-5-fluorotoluene |
| CAS No. | 349-01-9 |
| Synonyms | 1-Fluoro-5-methyl-2,4-dinitrobenzene |
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| Molecular Formula | C7H5FN2O4 |
| Molecular Weight | 200.124 |
| Density | 1.497g/cm3 |
| Melting point | 82℃ |
| Boiling point | 319°C at 760 mmHg |
| Flash point | 146.8°C |
| Refractive index | 1.575 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S38:In case of insufficient ventilation, wear suitable respiratory equipment.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
349-01-9 2,4-dinitro-5-fluorotoluene
service@apichina.com