| Product Name | 2,4-Dimethylthiosemicarbizide |
| CAS No. | 6621-75-6 |
| Synonyms | 2,4-Dimethylthiosemicarbazide; N,1-dimethylhydrazinecarbothioamide |
| InChI | InChI=1/C3H9N3S/c1-5-3(7)6(2)4/h4H2,1-2H3,(H,5,7) |
| Molecular Formula | C3H9N3S |
| Molecular Weight | 119.1887 |
| Density | 1.159g/cm3 |
| Boiling point | 171.3°C at 760 mmHg |
| Flash point | 57.4°C |
| Refractive index | 1.577 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
6621-75-6 2,4-dimethylthiosemicarbizide
service@apichina.com