| Product Name | 2,4-dimethylquinoline |
| CAS No. | 1198-37-4 |
| Synonyms | Dimethylquinoline |
| InChI | InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.2117 |
| Density | 1.052g/cm3 |
| Boiling point | 263.8°C at 760 mmHg |
| Flash point | 107.6°C |
| Refractive index | 1.61 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1198-37-4 2,4-dimethylquinoline
service@apichina.com