| Product Name | 2,4-Dimethylphenylthiourea |
| CAS No. | 16738-20-8 |
| Synonyms | Thiourea, (2,4-dimethylphenyl)- (9CI); (2,4-Xylyl) thiourea; 2,4-Xylylthiourea; 2-12-00-00609 (Beilstein Handbook Reference); 2-Thio-1-(2,4-xylyl)urea; BRN 2639862; Urea, 2-thio-1-(2,4-xylyl)-; 1-(2,4-dimethylphenyl)thiourea |
| InChI | InChI=1/C9H12N2S/c1-6-3-4-8(7(2)5-6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.27 |
| Density | 1.2g/cm3 |
| Boiling point | 290.7°C at 760 mmHg |
| Flash point | 129.6°C |
| Refractive index | 1.674 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
16738-20-8 2,4-dimethylphenylthiourea
service@apichina.com