| Product Name | 2,4-Dimethylphenylthiosemicarbazide |
| CAS No. | 66298-09-7 |
| Synonyms | 4-(2,4-Dimethylphenyl)-3-thiosemicarbazide; N-(2,4-dimethylphenyl)hydrazinecarbothioamide |
| InChI | InChI=1/C9H13N3S/c1-6-3-4-8(7(2)5-6)11-9(13)12-10/h3-5H,10H2,1-2H3,(H2,11,12,13) |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.2846 |
| Density | 1.228g/cm3 |
| Boiling point | 310.5°C at 760 mmHg |
| Flash point | 141.6°C |
| Refractive index | 1.678 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
66298-09-7 2,4-dimethylphenylthiosemicarbazide
service@apichina.com