| Product Name | 2,4-Dimethyl-2-imidazoline |
| CAS No. | 930-61-0 |
| Synonyms | 1H-Imidazole, 4,5-dihydro-2,5-dimethyl-; 1H-Imidazole, 4,5-dihydro-2,4-dimethyl-; 4,5-Dihydro-2,4-dimethyl-1H-imidazole; 2,5-dimethyl-4,5-dihydro-1H-imidazole |
| InChI | InChI=1/C5H10N2/c1-4-3-6-5(2)7-4/h4H,3H2,1-2H3,(H,6,7) |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.1463 |
| Density | 1.07g/cm3 |
| Boiling point | 198.6°C at 760 mmHg |
| Flash point | 73.9°C |
| Refractive index | 1.54 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
930-61-0 2,4-dimethyl-2-imidazoline
service@apichina.com