| Product Name | 2,4-dimethyl-1,3-thiazole-5-carbaldehyde |
| CAS No. | 95453-54-6 |
| Synonyms | 2,4-dimethylthiazole-5-carbaldehyde |
| InChI | InChI=1/C6H7NOS/c1-4-6(3-8)9-5(2)7-4/h3H,1-2H3 |
| Molecular Formula | C6H7NOS |
| Molecular Weight | 141.1909 |
| Density | 1.213g/cm3 |
| Boiling point | 238.884°C at 760 mmHg |
| Flash point | 98.274°C |
| Refractive index | 1.588 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
95453-54-6 2,4-dimethyl-1,3-thiazole-5-carbaldehyde
service@apichina.com