| Product Name | (2,4-dimethyl-1,3-thiazol-5-yl)methanol |
| CAS No. | 50382-32-6 |
| Synonyms | (2,4-dimethylthiazol-5-yl)methanol; |
| InChI | InChI=1/C6H9NOS/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.2068 |
| Density | 1.208g/cm3 |
| Melting point | 46℃ |
| Boiling point | 261.965°C at 760 mmHg |
| Flash point | 112.233°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
50382-32-6 (2,4-dimethyl-1,3-thiazol-5-yl)methanol
service@apichina.com