| Product Name | 2,4-dimethoxyphenyl isothiocyanate |
| CAS No. | 33904-03-9 |
| InChI | InChI=1/C9H9NO2S/c1-11-7-3-4-8(10-6-13)9(5-7)12-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.2383 |
| Density | 1.12g/cm3 |
| Melting point | 51℃ |
| Boiling point | 331°C at 760 mmHg |
| Flash point | 154°C |
| Refractive index | 1.537 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
33904-03-9 2,4-dimethoxyphenyl isothiocyanate
service@apichina.com