| Product Name | 2,4- dimethoxybenzoyl chloride |
| CAS No. | 39828-35-8 |
| Synonyms | 2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy- |
| InChI | InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.619 |
| Density | 1.224g/cm3 |
| Melting point | 58℃ |
| Boiling point | 306.7°C at 760 mmHg |
| Flash point | 134.1°C |
| Refractive index | 1.52 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
39828-35-8 2,4- dimethoxybenzoyl chloride
service@apichina.com