| Product Name | 2,4-Dimethoxybenzaldoxime |
| CAS No. | 31874-34-7 |
| Synonyms | 1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
| InChI | InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.1885 |
| Density | 1.11g/cm3 |
| Boiling point | 304.9°C at 760 mmHg |
| Flash point | 138.2°C |
| Refractive index | 1.501 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
31874-34-7 2,4-dimethoxybenzaldoxime
service@apichina.com