| Product Name | 2,4-difluorophenylhydrazine |
| CAS No. | 40594-30-7 |
| Synonyms | 1-(2,4-Difluorophenyl)hydrazine; (2,4-difluorophenyl)hydrazine hydrochloride |
| InChI | InChI=1/C6H6F2N2.ClH/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H |
| Molecular Formula | C6H7ClF2N2 |
| Molecular Weight | 180.583 |
| Melting point | 65-67℃ |
| Boiling point | 185.1°C at 760 mmHg |
| Flash point | 65.7°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
40594-30-7 2,4-difluorophenylhydrazine
service@apichina.com