| Product Name | 2,4-Difluorobenzoic Acid |
| CAS No. | 1583-58-0 |
| Synonyms | 2,4-DFBA; RARECHEM AL BO 0245; 2,4-Difluorobenzonicacid; Benzoic acid, 2,4-difluoro-; 2,4-difluorobenzoic acid the derivatives; 2,4-DIFLUOROBENZOIC ACID AND THE DERIVATIVES; 2,4-Difluorobenzoic acid 98%; 2,4-difluoropbenzoic acid; 2-fluoro-4-methyl-1-(trifluoromethyl)benzene; 2,4-difluorobenzoate |
| InChI | InChI=1/C7H4F2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)/p-1 |
| Molecular Formula | C7H3F2O2 |
| Molecular Weight | 157.0949 |
| Melting point | 186-190℃ |
| Boiling point | 239.5°C at 760 mmHg |
| Flash point | 98.6°C |
| Water solubility | SOLUBLE |
| Hazard Symbols | |
| Risk Codes | R36/37/38:; |
| Safety | S26:; S37/39:; |
1583-58-0 2,4-difluorobenzoic acid
service@apichina.com