| Product Name | 2,4-dichloro-N-hydroxybenzenecarboximidoyl chloride |
| CAS No. | 29203-60-9 |
| InChI | InChI=1/C7H4Cl3NO/c8-4-1-2-5(6(9)3-4)7(10)11-12/h1-3,12H |
| Molecular Formula | C7H4Cl3NO |
| Molecular Weight | 224.4718 |
| Density | 1.53g/cm3 |
| Melting point | 94℃ |
| Boiling point | 339.7°C at 760 mmHg |
| Flash point | 159.2°C |
| Refractive index | 1.597 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
29203-60-9 2,4-dichloro-n-hydroxybenzenecarboximidoyl chloride
service@apichina.com