| Product Name | 2,4-Dichloro-Alpha-methylbenzyl alcohol |
| CAS No. | 1475-13-4 |
| Synonyms | Benzyl alcohol, 2,4-dichloro-alpha-methyl-; 1-(2,4-dichlorophenyl)ethanol; (1S)-1-(2,4-dichlorophenyl)ethanol; (1R)-1-(2,4-dichlorophenyl)ethanol; 2,4-Dichloro-a-methylbenzyl alcohol |
| InChI | InChI=1/C8H8Cl2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-5,11H,1H3/t5-/m1/s1 |
| Molecular Formula | C8H8Cl2O |
| Molecular Weight | 191.0545 |
| Density | 1.323g/cm3 |
| Boiling point | 270.7°C at 760 mmHg |
| Flash point | 115.6°C |
| Refractive index | 1.566 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1475-13-4 2,4-dichloro-alpha-methylbenzyl alcohol
service@apichina.com