| Product Name | 2,4-Dichloro-6-n-propoxy-1,3,5-triazine |
| CAS No. | 26650-75-9 |
| Synonyms | 2,4-Dichloro-n-propoxy-s-triazine~n-Propoxydichloro-s-triazine; 2,4-dichloro-6-propoxy-1,3,5-triazine |
| InChI | InChI=1/C6H7Cl2N3O/c1-2-3-12-6-10-4(7)9-5(8)11-6/h2-3H2,1H3 |
| Molecular Formula | C6H7Cl2N3O |
| Molecular Weight | 208.0453 |
| Density | 1.386g/cm3 |
| Boiling point | 348.1°C at 760 mmHg |
| Flash point | 164.3°C |
| Refractive index | 1.528 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26650-75-9 2,4-dichloro-6-n-propoxy-1,3,5-triazine
service@apichina.com