| Product Name | 2,4-Dichloro-6-methylbenzylamine |
| CAS No. | 150517-76-3 |
| Synonyms | 1-(2,4-dichloro-6-methylphenyl)methanamine |
| InChI | InChI=1/C8H9Cl2N/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,4,11H2,1H3 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.0698 |
| Density | 1.27g/cm3 |
| Melting point | 54℃ |
| Boiling point | 278.6°C at 760 mmHg |
| Flash point | 122.3°C |
| Refractive index | 1.573 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
150517-76-3 2,4-dichloro-6-methylbenzylamine
service@apichina.com