| Product Name | 2,4-Dichloro-6-methylbenzonitrile |
| CAS No. | 175277-98-2 |
| Synonyms | 4,6-Dichloro-o-tolunitrile |
| InChI | InChI=1/C8H5Cl2N/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,1H3 |
| Molecular Formula | C8H5Cl2N |
| Molecular Weight | 186.038 |
| Density | 1.34g/cm3 |
| Boiling point | 287°C at 760 mmHg |
| Flash point | 124.1°C |
| Refractive index | 1.572 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
175277-98-2 2,4-dichloro-6-methylbenzonitrile
service@apichina.com