| Product Name | 2,4-dichloro-6-methylbenzamide |
| CAS No. | 175278-27-0 |
| InChI | InChI=1/C8H7Cl2NO/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3H,1H3,(H2,11,12) |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.0533 |
| Density | 1.375g/cm3 |
| Melting point | 151℃ |
| Boiling point | 265.1°C at 760 mmHg |
| Flash point | 114.1°C |
| Refractive index | 1.586 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175278-27-0 2,4-dichloro-6-methylbenzamide
service@apichina.com