| Product Name | 2,4-Dichloro-6-methylaniline |
| CAS No. | 30273-00-8 |
| Synonyms | 4,6-Dichloro-o-toluidine |
| InChI | InChI=1/C7H7Cl2N/c1-4-2-5(8)3-6(9)7(4)10/h2-3H,10H2,1H3 |
| Molecular Formula | C7H7Cl2N |
| Molecular Weight | 176.0432 |
| Density | 1.334g/cm3 |
| Melting point | 43-45℃ |
| Boiling point | 263.8°C at 760 mmHg |
| Flash point | 113.4°C |
| Refractive index | 1.599 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; R52:Harmful to aquatic organisms.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
30273-00-8 2,4-dichloro-6-methylaniline
service@apichina.com